C22H14BrN3O4S — CID 126398343
(2E)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 126398343) has the molecular formula C22H14BrN3O4S and a molecular weight of 496.34 g/mol. Its IUPAC name is (2E)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2E)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 126398343 |
| Molecular Formula | C22H14BrN3O4S |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | (2E)-2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | Cc1cc2nc3s/c(=C/c4ccc(-c5ccc([N+](=O)[O-])cc5Br)o4)c(=O)n3c2cc1C |
| InChI | InChI=1S/C22H14BrN3O4S/c1-11-7-17-18(8-12(11)2)25-21(27)20(31-22(25)24-17)10-14-4-6-19(30-14)15-5-3-13(26(28)29)9-16(15)23/h3-10H,1-2H3/b20-10+ |
| InChIKey | SFOJPTWBRCVCGX-KEBDBYFISA-N |
| XLogP | 5.00 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|