C21H13N3O4S — CID 1041878
(2Z)-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 1041878) has the molecular formula C21H13N3O4S and a molecular weight of 403.42 g/mol. Its IUPAC name is (2Z)-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2Z)-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 1041878 |
| Molecular Formula | C21H13N3O4S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (2Z)-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1ccc(/C=c2\sc3nc4ccccc4n3c2=O)o1 |
| InChI | InChI=1S/C21H13N3O4S/c1-12-6-7-13(24(26)27)10-15(12)18-9-8-14(28-18)11-19-20(25)23-17-5-3-2-4-16(17)22-21(23)29-19/h2-11H,1H3/b19-11- |
| InChIKey | JSWDFTRDLPNICR-ODLFYWEKSA-N |
| XLogP | 3.93 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|