C20H10ClN3O4S — CID 5286975
(2E)-2-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 5286975) has the molecular formula C20H10ClN3O4S and a molecular weight of 423.84 g/mol. Its IUPAC name is (2E)-2-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2E)-2-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 5286975 |
| Molecular Formula | C20H10ClN3O4S |
| Molecular Weight | 423.84 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | (2E)-2-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | O=c1/c(=C\c2ccc(-c3ccc(Cl)cc3[N+](=O)[O-])o2)sc2nc3ccccc3n12 |
| InChI | InChI=1S/C20H10ClN3O4S/c21-11-5-7-13(16(9-11)24(26)27)17-8-6-12(28-17)10-18-19(25)23-15-4-2-1-3-14(15)22-20(23)29-18/h1-10H/b18-10+ |
| InChIKey | AZARPWMMUILAMF-VCHYOVAHSA-N |
| XLogP | 4.28 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|