C28H14N2O4S — CID 6737986
1-[5-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]furan-2-yl]anthracene-9,10-dione (PubChem CID 6737986) has the molecular formula C28H14N2O4S and a molecular weight of 474.50 g/mol. Its IUPAC name is 1-[5-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]furan-2-yl]anthracene-9,10-dione.
| Compound Name | 1-[5-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]furan-2-yl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 6737986 |
| Molecular Formula | C28H14N2O4S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 1-[5-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]furan-2-yl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2-c1ccc(C=c2sc3nc4ccccc4n3c2=O)o1 |
| InChI | InChI=1S/C28H14N2O4S/c31-25-16-6-1-2-7-17(16)26(32)24-18(8-5-9-19(24)25)22-13-12-15(34-22)14-23-27(33)30-21-11-4-3-10-20(21)29-28(30)35-23/h1-14H |
| InChIKey | IOUDTOHLUMFKAX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|