C15H10BrN3O3S — CID 91564597
5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-1,6-dihydropyrimidine-2-thione (PubChem CID 91564597) has the molecular formula C15H10BrN3O3S and a molecular weight of 392.23 g/mol. Its IUPAC name is 5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-1,6-dihydropyrimidine-2-thione.
| Compound Name | 5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-1,6-dihydropyrimidine-2-thione |
|---|---|
| PubChem CID | 91564597 |
| Molecular Formula | C15H10BrN3O3S |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-1,6-dihydropyrimidine-2-thione |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(C=C3C=NC(=S)NC3)o2)c(Br)c1 |
| InChI | InChI=1S/C15H10BrN3O3S/c16-13-6-10(19(20)21)1-3-12(13)14-4-2-11(22-14)5-9-7-17-15(23)18-8-9/h1-7H,8H2,(H,18,23) |
| InChIKey | SGDLQOIRJCYBJN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|