C22H16BrN3O4 — CID 145408591
(4Z)-4-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-methyl-2-(3-methylphenyl)pyrazol-3-one (PubChem CID 145408591) has the molecular formula C22H16BrN3O4 and a molecular weight of 466.29 g/mol. Its IUPAC name is (4Z)-4-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-methyl-2-(3-methylphenyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-methyl-2-(3-methylphenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 145408591 |
| Molecular Formula | C22H16BrN3O4 |
| Molecular Weight | 466.29 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | (4Z)-4-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-5-methyl-2-(3-methylphenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2cccc(C)c2)C(=O)/C1=C\c1ccc(-c2ccc([N+](=O)[O-])cc2Br)o1 |
| InChI | InChI=1S/C22H16BrN3O4/c1-13-4-3-5-15(10-13)25-22(27)19(14(2)24-25)12-17-7-9-21(30-17)18-8-6-16(26(28)29)11-20(18)23/h3-12H,1-2H3/b19-12- |
| InChIKey | SDYUGGPLBTYVRK-UNOMPAQXSA-N |
| XLogP | 5.73 |
| TPSA | 88.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.29 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|