C23H20N6O5 — CID 126004593
(4E)-4-[[1-(2,4-dinitrophenyl)-3,5-dimethylpyrazol-4-yl]methylidene]-5-methyl-2-(3-methylphenyl)pyrazol-3-one (PubChem CID 126004593) has the molecular formula C23H20N6O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is (4E)-4-[[1-(2,4-dinitrophenyl)-3,5-dimethylpyrazol-4-yl]methylidene]-5-methyl-2-(3-methylphenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[1-(2,4-dinitrophenyl)-3,5-dimethylpyrazol-4-yl]methylidene]-5-methyl-2-(3-methylphenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126004593 |
| Molecular Formula | C23H20N6O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (4E)-4-[[1-(2,4-dinitrophenyl)-3,5-dimethylpyrazol-4-yl]methylidene]-5-methyl-2-(3-methylphenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2cccc(C)c2)C(=O)/C1=C/c1c(C)nn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C23H20N6O5/c1-13-6-5-7-17(10-13)27-23(30)20(15(3)25-27)12-19-14(2)24-26(16(19)4)21-9-8-18(28(31)32)11-22(21)29(33)34/h5-12H,1-4H3/b20-12+ |
| InChIKey | PNNRPTTXMXKCTL-UDWIEESQSA-N |
| XLogP | 4.42 |
| TPSA | 136.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|