C25H18N6O6 — CID 154774377
2-(2,4-dinitrophenyl)-5-methyl-4-[[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]pyrazol-3-one (PubChem CID 154774377) has the molecular formula C25H18N6O6 and a molecular weight of 498.46 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-5-methyl-4-[[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]pyrazol-3-one.
| Compound Name | 2-(2,4-dinitrophenyl)-5-methyl-4-[[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 154774377 |
| Molecular Formula | C25H18N6O6 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-5-methyl-4-[[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]pyrazol-3-one |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)C1=Cc1cn(-c2ccccc2)nc1-c1ccc(C)o1 |
| InChI | InChI=1S/C25H18N6O6/c1-15-8-11-23(37-15)24-17(14-28(27-24)18-6-4-3-5-7-18)12-20-16(2)26-29(25(20)32)21-10-9-19(30(33)34)13-22(21)31(35)36/h3-14H,1-2H3 |
| InChIKey | IEOAUCVTEGNCQX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 149.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|