C23H17N3O6 — CID 59455935
4-[(4Z)-3-methyl-4-[[5-(5-methyl-2-nitrophenyl)furan-2-yl]methylidene]-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 59455935) has the molecular formula C23H17N3O6 and a molecular weight of 431.40 g/mol. Its IUPAC name is 4-[(4Z)-3-methyl-4-[[5-(5-methyl-2-nitrophenyl)furan-2-yl]methylidene]-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4Z)-3-methyl-4-[[5-(5-methyl-2-nitrophenyl)furan-2-yl]methylidene]-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 59455935 |
| Molecular Formula | C23H17N3O6 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 4-[(4Z)-3-methyl-4-[[5-(5-methyl-2-nitrophenyl)furan-2-yl]methylidene]-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CC1=NN(c2ccc(C(=O)O)cc2)C(=O)/C1=C\c1ccc(-c2cc(C)ccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C23H17N3O6/c1-13-3-9-20(26(30)31)19(11-13)21-10-8-17(32-21)12-18-14(2)24-25(22(18)27)16-6-4-15(5-7-16)23(28)29/h3-12H,1-2H3,(H,28,29)/b18-12- |
| InChIKey | BIGZHIAAROLPGV-PDGQHHTCSA-N |
| XLogP | 4.67 |
| TPSA | 126.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|