C21H14BrNO4 — CID 4263294
2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 4263294) has the molecular formula C21H14BrNO4 and a molecular weight of 424.25 g/mol. Its IUPAC name is 2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 4263294 |
| Molecular Formula | C21H14BrNO4 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1C(=Cc2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)CCc2ccccc21 |
| InChI | InChI=1S/C21H14BrNO4/c22-19-12-15(23(25)26)7-9-18(19)20-10-8-16(27-20)11-14-6-5-13-3-1-2-4-17(13)21(14)24/h1-4,7-12H,5-6H2 |
| InChIKey | OVNXOJYQEMOJIH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 73.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|