C20H17BrN2O5S — CID 4224004
5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-(3,3-dimethyl-2-oxobutylidene)-1,3-thiazolidin-4-one (PubChem CID 4224004) has the molecular formula C20H17BrN2O5S and a molecular weight of 477.34 g/mol. Its IUPAC name is 5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-(3,3-dimethyl-2-oxobutylidene)-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-(3,3-dimethyl-2-oxobutylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4224004 |
| Molecular Formula | C20H17BrN2O5S |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | 5-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylidene]-2-(3,3-dimethyl-2-oxobutylidene)-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)C(=O)C=c1[nH]c(=O)c(=Cc2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)s1 |
| InChI | InChI=1S/C20H17BrN2O5S/c1-20(2,3)17(24)10-18-22-19(25)16(29-18)9-12-5-7-15(28-12)13-6-4-11(23(26)27)8-14(13)21/h4-10H,1-3H3,(H,22,25) |
| InChIKey | POMPJRPENCFXCC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|