C23H19NO4 — CID 2095613
(2Z)-5,7-dimethyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 2095613) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2Z)-5,7-dimethyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2Z)-5,7-dimethyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 2095613 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (2Z)-5,7-dimethyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | Cc1cc(C)c2c(c1)C(=O)/C(=C\c1ccc(-c3ccc([N+](=O)[O-])cc3)o1)CC2 |
| InChI | InChI=1S/C23H19NO4/c1-14-11-15(2)20-9-5-17(23(25)21(20)12-14)13-19-8-10-22(28-19)16-3-6-18(7-4-16)24(26)27/h3-4,6-8,10-13H,5,9H2,1-2H3/b17-13- |
| InChIKey | JTVOGWBHOJRLRS-LGMDPLHJSA-N |
| XLogP | 5.68 |
| TPSA | 73.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|