C23H24N2O3 — CID 5234776
5,7-dimethyl-2-[(3-nitro-4-pyrrolidin-1-ylphenyl)methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 5234776) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 5,7-dimethyl-2-[(3-nitro-4-pyrrolidin-1-ylphenyl)methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | 5,7-dimethyl-2-[(3-nitro-4-pyrrolidin-1-ylphenyl)methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 5234776 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 5,7-dimethyl-2-[(3-nitro-4-pyrrolidin-1-ylphenyl)methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | Cc1cc(C)c2c(c1)C(=O)C(=Cc1ccc(N3CCCC3)c([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C23H24N2O3/c1-15-11-16(2)19-7-6-18(23(26)20(19)12-15)13-17-5-8-21(22(14-17)25(27)28)24-9-3-4-10-24/h5,8,11-14H,3-4,6-7,9-10H2,1-2H3 |
| InChIKey | VJRNHWBLIQHRJT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|