C16H19N3O2 — CID 5013770
2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrole (PubChem CID 5013770) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrole.
| Compound Name | 2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrole |
|---|---|
| PubChem CID | 5013770 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrole |
| SMILES | Cc1ccc(C)n1-c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N3O2/c1-12-5-6-13(2)18(12)14-7-8-15(16(11-14)19(20)21)17-9-3-4-10-17/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | CHWMWYIHRAQNNK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|