C24H24Cl2N4O4 — CID 3287739
(3,5-dichloro-4-methoxyphenyl)-[4-[4-(2,5-dimethylpyrrol-1-yl)-2-nitrophenyl]piperazin-1-yl]methanone (PubChem CID 3287739) has the molecular formula C24H24Cl2N4O4 and a molecular weight of 503.39 g/mol. Its IUPAC name is (3,5-dichloro-4-methoxyphenyl)-[4-[4-(2,5-dimethylpyrrol-1-yl)-2-nitrophenyl]piperazin-1-yl]methanone.
| Compound Name | (3,5-dichloro-4-methoxyphenyl)-[4-[4-(2,5-dimethylpyrrol-1-yl)-2-nitrophenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3287739 |
| Molecular Formula | C24H24Cl2N4O4 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | (3,5-dichloro-4-methoxyphenyl)-[4-[4-(2,5-dimethylpyrrol-1-yl)-2-nitrophenyl]piperazin-1-yl]methanone |
| SMILES | COc1c(Cl)cc(C(=O)N2CCN(c3ccc(-n4c(C)ccc4C)cc3[N+](=O)[O-])CC2)cc1Cl |
| InChI | InChI=1S/C24H24Cl2N4O4/c1-15-4-5-16(2)29(15)18-6-7-21(22(14-18)30(32)33)27-8-10-28(11-9-27)24(31)17-12-19(25)23(34-3)20(26)13-17/h4-7,12-14H,8-11H2,1-3H3 |
| InChIKey | XFNXNHMDOFCFMW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 80.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|