C18H14ClF4N3O4 — CID 17110314
[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methanone (PubChem CID 17110314) has the molecular formula C18H14ClF4N3O4 and a molecular weight of 447.77 g/mol. Its IUPAC name is [4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methanone.
| Compound Name | [4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 17110314 |
| Molecular Formula | C18H14ClF4N3O4 |
| Molecular Weight | 447.77 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | [4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methanone |
| SMILES | COc1c(F)c(F)c(C(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)c(F)c1F |
| InChI | InChI=1S/C18H14ClF4N3O4/c1-30-17-15(22)13(20)12(14(21)16(17)23)18(27)25-6-4-24(5-7-25)10-3-2-9(19)8-11(10)26(28)29/h2-3,8H,4-7H2,1H3 |
| InChIKey | RYGRTDLXFUNQAC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.77 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|