C21H14Cl2O2 — CID 7946893
(2E)-2-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 7946893) has the molecular formula C21H14Cl2O2 and a molecular weight of 369.25 g/mol. Its IUPAC name is (2E)-2-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 7946893 |
| Molecular Formula | C21H14Cl2O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (2E)-2-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1/C(=C/c2ccc(-c3cccc(Cl)c3Cl)o2)CCc2ccccc21 |
| InChI | InChI=1S/C21H14Cl2O2/c22-18-7-3-6-17(20(18)23)19-11-10-15(25-19)12-14-9-8-13-4-1-2-5-16(13)21(14)24/h1-7,10-12H,8-9H2/b14-12+ |
| InChIKey | PZQYANARSLADEW-WYMLVPIESA-N |
| XLogP | 6.47 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|