C17H13NOS — CID 135409428
4-[(E)-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl]phenol (PubChem CID 135409428) has the molecular formula C17H13NOS and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-[(E)-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl]phenol.
| Compound Name | 4-[(E)-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 135409428 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-[(E)-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl]phenol |
| SMILES | Oc1ccc(/C=C/c2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C17H13NOS/c19-15-9-6-13(7-10-15)8-11-17-18-16(12-20-17)14-4-2-1-3-5-14/h1-12,19H/b11-8+ |
| InChIKey | OWGKNPAOKVVDOK-DHZHZOJOSA-N |
| XLogP | 4.69 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |