C26H19N3S — CID 3250858
2-[2-(1,3-diphenylpyrazol-4-yl)ethenyl]-4-phenyl-1,3-thiazole (PubChem CID 3250858) has the molecular formula C26H19N3S and a molecular weight of 405.53 g/mol. Its IUPAC name is 2-[2-(1,3-diphenylpyrazol-4-yl)ethenyl]-4-phenyl-1,3-thiazole.
| Compound Name | 2-[2-(1,3-diphenylpyrazol-4-yl)ethenyl]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 3250858 |
| Molecular Formula | C26H19N3S |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[2-(1,3-diphenylpyrazol-4-yl)ethenyl]-4-phenyl-1,3-thiazole |
| SMILES | C(=Cc1cn(-c2ccccc2)nc1-c1ccccc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C26H19N3S/c1-4-10-20(11-5-1)24-19-30-25(27-24)17-16-22-18-29(23-14-8-3-9-15-23)28-26(22)21-12-6-2-7-13-21/h1-19H |
| InChIKey | UGGPZJWTMOXJLZ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |