C18H15ClN2 — CID 169478562
4-(3-chloroprop-1-enyl)-1,3-diphenylpyrazole (PubChem CID 169478562) has the molecular formula C18H15ClN2 and a molecular weight of 294.79 g/mol. Its IUPAC name is 4-(3-chloroprop-1-enyl)-1,3-diphenylpyrazole.
| Compound Name | 4-(3-chloroprop-1-enyl)-1,3-diphenylpyrazole |
|---|---|
| PubChem CID | 169478562 |
| Molecular Formula | C18H15ClN2 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-(3-chloroprop-1-enyl)-1,3-diphenylpyrazole |
| SMILES | ClCC=Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H15ClN2/c19-13-7-10-16-14-21(17-11-5-2-6-12-17)20-18(16)15-8-3-1-4-9-15/h1-12,14H,13H2 |
| InChIKey | WVFLWZAJIHMYGI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|