C22H17N3O — CID 139051830
1-(1,3-diphenylpyrazol-4-yl)-N-phenylmethanimine oxide (PubChem CID 139051830) has the molecular formula C22H17N3O and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-(1,3-diphenylpyrazol-4-yl)-N-phenylmethanimine oxide.
| Compound Name | 1-(1,3-diphenylpyrazol-4-yl)-N-phenylmethanimine oxide |
|---|---|
| PubChem CID | 139051830 |
| Molecular Formula | C22H17N3O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-(1,3-diphenylpyrazol-4-yl)-N-phenylmethanimine oxide |
| SMILES | [O-]/[N+](=C\c1cn(-c2ccccc2)nc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O/c26-25(21-14-8-3-9-15-21)17-19-16-24(20-12-6-2-7-13-20)23-22(19)18-10-4-1-5-11-18/h1-17H/b25-17- |
| InChIKey | HGTOWVRJDVRXDH-UQQQWYQISA-N |
| XLogP | 4.80 |
| TPSA | 43.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|