C29H21N5OS — CID 139235497
4-[(1,3-diphenylpyrazol-4-yl)methylidene]-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one (PubChem CID 139235497) has the molecular formula C29H21N5OS and a molecular weight of 487.59 g/mol. Its IUPAC name is 4-[(1,3-diphenylpyrazol-4-yl)methylidene]-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one.
| Compound Name | 4-[(1,3-diphenylpyrazol-4-yl)methylidene]-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one |
|---|---|
| PubChem CID | 139235497 |
| Molecular Formula | C29H21N5OS |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 4-[(1,3-diphenylpyrazol-4-yl)methylidene]-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one |
| SMILES | CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)C1=Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C29H21N5OS/c1-20-25(28(35)34(31-20)29-30-26(19-36-29)21-11-5-2-6-12-21)17-23-18-33(24-15-9-4-10-16-24)32-27(23)22-13-7-3-8-14-22/h2-19H,1H3 |
| InChIKey | YOURPCHUPSSYJX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|