C32H31N5O3S — CID 18806771
(4Z)-5-methyl-4-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one (PubChem CID 18806771) has the molecular formula C32H31N5O3S and a molecular weight of 565.70 g/mol. Its IUPAC name is (4Z)-5-methyl-4-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-5-methyl-4-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 18806771 |
| Molecular Formula | C32H31N5O3S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | (4Z)-5-methyl-4-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C\c1cn(-c2ccccc2)nc1-c1cccc(S(=O)(=O)N2CCCC(C)C2)c1 |
| InChI | InChI=1S/C32H31N5O3S/c1-23-11-10-18-35(21-23)41(39,40)29-17-9-12-25(19-29)31-26(22-36(34-31)27-13-5-3-6-14-27)20-30-24(2)33-37(32(30)38)28-15-7-4-8-16-28/h3-9,12-17,19-20,22-23H,10-11,18,21H2,1-2H3/b30-20- |
| InChIKey | URNPYMGQXAXXRY-COEJQBHMSA-N |
| XLogP | 5.77 |
| TPSA | 87.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|