C38H37N5O5S — CID 19113064
(5E)-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-5-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19113064) has the molecular formula C38H37N5O5S and a molecular weight of 675.81 g/mol. Its IUPAC name is (5E)-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-5-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-5-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19113064 |
| Molecular Formula | C38H37N5O5S |
| Molecular Weight | 675.81 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | (5E)-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-5-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1ccc(CCN2C(=O)C(C#N)=C(C)/C(=C\c3cn(-c4ccccc4)nc3-c3cccc(S(=O)(=O)N4CCCC(C)C4)c3)C2=O)cc1 |
| InChI | InChI=1S/C38H37N5O5S/c1-26-9-8-19-41(24-26)49(46,47)33-13-7-10-29(21-33)36-30(25-43(40-36)31-11-5-4-6-12-31)22-34-27(2)35(23-39)38(45)42(37(34)44)20-18-28-14-16-32(48-3)17-15-28/h4-7,10-17,21-22,25-26H,8-9,18-20,24H2,1-3H3/b34-22+ |
| InChIKey | DMCMQMGEAUABRR-PPOKSSTKSA-N |
| XLogP | 5.80 |
| TPSA | 125.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.81 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|