C33H26N4O5 — CID 19112874
(5E)-5-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112874) has the molecular formula C33H26N4O5 and a molecular weight of 558.59 g/mol. Its IUPAC name is (5E)-5-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112874 |
| Molecular Formula | C33H26N4O5 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | (5E)-5-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1ccc(CN2C(=O)C(C#N)=C(C)/C(=C\c3cn(-c4ccccc4)nc3-c3ccc4c(c3)OCCO4)C2=O)cc1 |
| InChI | InChI=1S/C33H26N4O5/c1-21-27(32(38)36(33(39)28(21)18-34)19-22-8-11-26(40-2)12-9-22)16-24-20-37(25-6-4-3-5-7-25)35-31(24)23-10-13-29-30(17-23)42-15-14-41-29/h3-13,16-17,20H,14-15,19H2,1-2H3/b27-16+ |
| InChIKey | BKTZOYOTRWYOSY-JVWAILMASA-N |
| XLogP | 5.11 |
| TPSA | 106.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|