C35H24N4O4 — CID 19112716
(5E)-1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-5-[(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112716) has the molecular formula C35H24N4O4 and a molecular weight of 564.60 g/mol. Its IUPAC name is (5E)-1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-5-[(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-5-[(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112716 |
| Molecular Formula | C35H24N4O4 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | (5E)-1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-5-[(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2ccc3c(c2)OCO3)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H24N4O4/c1-22-29(34(40)38(35(41)30(22)18-36)19-23-11-14-31-32(15-23)43-21-42-31)17-27-20-39(28-9-3-2-4-10-28)37-33(27)26-13-12-24-7-5-6-8-25(24)16-26/h2-17,20H,19,21H2,1H3/b29-17+ |
| InChIKey | IYRJHFHSWFPERJ-STBIYBPSSA-N |
| XLogP | 6.21 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|