C31H23ClN4O2 — CID 19113289
(5E)-1-[(2-chlorophenyl)methyl]-4-methyl-5-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19113289) has the molecular formula C31H23ClN4O2 and a molecular weight of 519.00 g/mol. Its IUPAC name is (5E)-1-[(2-chlorophenyl)methyl]-4-methyl-5-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-[(2-chlorophenyl)methyl]-4-methyl-5-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19113289 |
| Molecular Formula | C31H23ClN4O2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (5E)-1-[(2-chlorophenyl)methyl]-4-methyl-5-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2ccccc2Cl)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C31H23ClN4O2/c1-20-12-14-22(15-13-20)29-24(19-36(34-29)25-9-4-3-5-10-25)16-26-21(2)27(17-33)31(38)35(30(26)37)18-23-8-6-7-11-28(23)32/h3-16,19H,18H2,1-2H3/b26-16+ |
| InChIKey | YUXRHNPOLYICOZ-WGOQTCKBSA-N |
| XLogP | 6.29 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|