C35H25ClN4O4 — CID 19111496
(5E)-5-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1-(furan-2-ylmethyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19111496) has the molecular formula C35H25ClN4O4 and a molecular weight of 601.06 g/mol. Its IUPAC name is (5E)-5-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1-(furan-2-ylmethyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1-(furan-2-ylmethyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111496 |
| Molecular Formula | C35H25ClN4O4 |
| Molecular Weight | 601.06 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | (5E)-5-[[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1-(furan-2-ylmethyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2ccco2)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C35H25ClN4O4/c1-23-30(34(41)39(35(42)31(23)19-37)21-29-11-7-17-43-29)18-26-20-40(27-9-3-2-4-10-27)38-33(26)24-13-15-28(16-14-24)44-22-25-8-5-6-12-32(25)36/h2-18,20H,21-22H2,1H3/b30-18+ |
| InChIKey | XMCRZJXRNWWUFT-UXHLAJHPSA-N |
| XLogP | 7.16 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.06 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|