C36H32Cl2N4O3 — CID 19110138
(5E)-5-[[3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1-hexyl-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19110138) has the molecular formula C36H32Cl2N4O3 and a molecular weight of 639.58 g/mol. Its IUPAC name is (5E)-5-[[3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1-hexyl-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1-hexyl-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19110138 |
| Molecular Formula | C36H32Cl2N4O3 |
| Molecular Weight | 639.58 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | (5E)-5-[[3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1-hexyl-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCCCN1C(=O)C(C#N)=C(C)/C(=C\c2cn(-c3ccccc3)nc2-c2ccc(OCc3ccc(Cl)cc3Cl)cc2)C1=O |
| InChI | InChI=1S/C36H32Cl2N4O3/c1-3-4-5-9-18-41-35(43)31(24(2)32(21-39)36(41)44)19-27-22-42(29-10-7-6-8-11-29)40-34(27)25-13-16-30(17-14-25)45-23-26-12-15-28(37)20-33(26)38/h6-8,10-17,19-20,22H,3-5,9,18,23H2,1-2H3/b31-19+ |
| InChIKey | NPUBHXKVNMSVMJ-ZCTHSVRISA-N |
| XLogP | 8.60 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.58 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|