C35H30N4O5 — CID 19112736
(5E)-1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-5-[[3-(2-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112736) has the molecular formula C35H30N4O5 and a molecular weight of 586.65 g/mol. Its IUPAC name is (5E)-1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-5-[[3-(2-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-5-[[3-(2-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112736 |
| Molecular Formula | C35H30N4O5 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | (5E)-1-(1,3-benzodioxol-5-ylmethyl)-4-methyl-5-[[3-(2-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)C(C#N)=C2C)c(C)c1 |
| InChI | InChI=1S/C35H30N4O5/c1-4-14-42-27-11-12-28(22(2)15-27)33-25(20-39(37-33)26-8-6-5-7-9-26)17-29-23(3)30(18-36)35(41)38(34(29)40)19-24-10-13-31-32(16-24)44-21-43-31/h5-13,15-17,20H,4,14,19,21H2,1-3H3/b29-17+ |
| InChIKey | WTQJNTDIWAJTLC-STBIYBPSSA-N |
| XLogP | 6.16 |
| TPSA | 106.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|