C12H12N2S — CID 70042347
1-(4-phenyl-1,3-thiazol-2-yl)prop-1-en-2-amine (PubChem CID 70042347) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 1-(4-phenyl-1,3-thiazol-2-yl)prop-1-en-2-amine.
| Compound Name | 1-(4-phenyl-1,3-thiazol-2-yl)prop-1-en-2-amine |
|---|---|
| PubChem CID | 70042347 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-(4-phenyl-1,3-thiazol-2-yl)prop-1-en-2-amine |
| SMILES | CC(N)=Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C12H12N2S/c1-9(13)7-12-14-11(8-15-12)10-5-3-2-4-6-10/h2-8H,13H2,1H3 |
| InChIKey | CGCOTVKVYSMDQY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |