C10H7NOS — CID 3538814
4-phenyl-1,3-thiazole-2-carbaldehyde (PubChem CID 3538814) has the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. Its IUPAC name is 4-phenyl-1,3-thiazole-2-carbaldehyde.
| Compound Name | 4-phenyl-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 3538814 |
| Molecular Formula | C10H7NOS |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 4-phenyl-1,3-thiazole-2-carbaldehyde |
| SMILES | O=Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C10H7NOS/c12-6-10-11-9(7-13-10)8-4-2-1-3-5-8/h1-7H |
| InChIKey | DJWIXPPOXVIXSZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|