C11H7N5OS — CID 62927731
4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole-2-carbaldehyde (PubChem CID 62927731) has the molecular formula C11H7N5OS and a molecular weight of 257.28 g/mol. Its IUPAC name is 4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole-2-carbaldehyde.
| Compound Name | 4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 62927731 |
| Molecular Formula | C11H7N5OS |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole-2-carbaldehyde |
| SMILES | O=Cc1nc(-c2cccc(-n3cnnn3)c2)cs1 |
| InChI | InChI=1S/C11H7N5OS/c17-5-11-13-10(6-18-11)8-2-1-3-9(4-8)16-7-12-14-15-16/h1-7H |
| InChIKey | VUNKLHJCTYUVCE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|