C11H8ClN5S — CID 62922172
2-(chloromethyl)-4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole (PubChem CID 62922172) has the molecular formula C11H8ClN5S and a molecular weight of 277.74 g/mol. Its IUPAC name is 2-(chloromethyl)-4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole.
| Compound Name | 2-(chloromethyl)-4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 62922172 |
| Molecular Formula | C11H8ClN5S |
| Molecular Weight | 277.74 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-(chloromethyl)-4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole |
| SMILES | ClCc1nc(-c2cccc(-n3cnnn3)c2)cs1 |
| InChI | InChI=1S/C11H8ClN5S/c12-5-11-14-10(6-18-11)8-2-1-3-9(4-8)17-7-13-15-16-17/h1-4,6-7H,5H2 |
| InChIKey | CSBMKILMKNJORL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|