C14H16N6S — CID 62942366
N-tert-butyl-4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazol-2-amine (PubChem CID 62942366) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is N-tert-butyl-4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-tert-butyl-4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62942366 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-tert-butyl-4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)Nc1nc(-c2cccc(-n3cnnn3)c2)cs1 |
| InChI | InChI=1S/C14H16N6S/c1-14(2,3)17-13-16-12(8-21-13)10-5-4-6-11(7-10)20-9-15-18-19-20/h4-9H,1-3H3,(H,16,17) |
| InChIKey | BBNNWHKYSSOWJA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |