C13H11N5O2S — CID 61385361
ethyl 4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole-2-carboxylate (PubChem CID 61385361) has the molecular formula C13H11N5O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is ethyl 4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 61385361 |
| Molecular Formula | C13H11N5O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | ethyl 4-[3-(tetrazol-1-yl)phenyl]-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cccc(-n3cnnn3)c2)cs1 |
| InChI | InChI=1S/C13H11N5O2S/c1-2-20-13(19)12-15-11(7-21-12)9-4-3-5-10(6-9)18-8-14-16-17-18/h3-8H,2H2,1H3 |
| InChIKey | JRZKDDNCALWBND-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |