C17H12FNOS — CID 15477392
3-[(E)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethenyl]phenol (PubChem CID 15477392) has the molecular formula C17H12FNOS and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-[(E)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethenyl]phenol.
| Compound Name | 3-[(E)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethenyl]phenol |
|---|---|
| PubChem CID | 15477392 |
| Molecular Formula | C17H12FNOS |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-[(E)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethenyl]phenol |
| SMILES | Oc1cccc(/C=C/c2nc(-c3ccc(F)cc3)cs2)c1 |
| InChI | InChI=1S/C17H12FNOS/c18-14-7-5-13(6-8-14)16-11-21-17(19-16)9-4-12-2-1-3-15(20)10-12/h1-11,20H/b9-4+ |
| InChIKey | SMXSOYCXVAVPHG-RUDMXATFSA-N |
| XLogP | 4.83 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |