C20H28N8O4S — CID 123222432
2-[[4-(4-aminophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-2-(4-methylsulfonylpiperazin-1-yl)acetaldehyde (PubChem CID 123222432) has the molecular formula C20H28N8O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is 2-[[4-(4-aminophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-2-(4-methylsulfonylpiperazin-1-yl)acetaldehyde.
| Compound Name | 2-[[4-(4-aminophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-2-(4-methylsulfonylpiperazin-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 123222432 |
| Molecular Formula | C20H28N8O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-[[4-(4-aminophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-2-(4-methylsulfonylpiperazin-1-yl)acetaldehyde |
| SMILES | CS(=O)(=O)N1CCN(C(C=O)Nc2nc(-c3ccc(N)cc3)nc(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C20H28N8O4S/c1-33(30,31)28-8-6-26(7-9-28)17(14-29)22-19-23-18(15-2-4-16(21)5-3-15)24-20(25-19)27-10-12-32-13-11-27/h2-5,14,17H,6-13,21H2,1H3,(H,22,23,24,25) |
| InChIKey | RDXBXSMSNDCSDD-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|