C20H26N10O4S — CID 87200590
2-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-ylpurin-9-yl]-2-(4-methylsulfonylpiperazin-1-yl)acetaldehyde (PubChem CID 87200590) has the molecular formula C20H26N10O4S and a molecular weight of 502.56 g/mol. Its IUPAC name is 2-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-ylpurin-9-yl]-2-(4-methylsulfonylpiperazin-1-yl)acetaldehyde.
| Compound Name | 2-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-ylpurin-9-yl]-2-(4-methylsulfonylpiperazin-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 87200590 |
| Molecular Formula | C20H26N10O4S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 2-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-ylpurin-9-yl]-2-(4-methylsulfonylpiperazin-1-yl)acetaldehyde |
| SMILES | CS(=O)(=O)N1CCN(C(C=O)n2cnc3c(N4CCOCC4)nc(-c4cnc(N)nc4)nc32)CC1 |
| InChI | InChI=1S/C20H26N10O4S/c1-35(32,33)29-4-2-27(3-5-29)15(12-31)30-13-24-16-18(28-6-8-34-9-7-28)25-17(26-19(16)30)14-10-22-20(21)23-11-14/h10-13,15H,2-9H2,1H3,(H2,21,22,23) |
| InChIKey | XTRGCYANKTTZOB-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 165.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|