C19H27N11O2S — CID 159915750
5-[3-[[4-(methyl-methylidene-oxo-λ6-sulfanyl)piperazin-1-yl]methyl]-8-morpholin-4-yl-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl]pyrimidin-2-amine (PubChem CID 159915750) has the molecular formula C19H27N11O2S and a molecular weight of 473.57 g/mol. Its IUPAC name is 5-[3-[[4-(methyl-methylidene-oxo-λ6-sulfanyl)piperazin-1-yl]methyl]-8-morpholin-4-yl-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl]pyrimidin-2-amine.
| Compound Name | 5-[3-[[4-(methyl-methylidene-oxo-λ6-sulfanyl)piperazin-1-yl]methyl]-8-morpholin-4-yl-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 159915750 |
| Molecular Formula | C19H27N11O2S |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 5-[3-[[4-(methyl-methylidene-oxo-λ6-sulfanyl)piperazin-1-yl]methyl]-8-morpholin-4-yl-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl]pyrimidin-2-amine |
| SMILES | C=S(C)(=O)N1CCN(Cc2nnc3c(N4CCOCC4)nc(-c4cnc(N)nc4)nn23)CC1 |
| InChI | InChI=1S/C19H27N11O2S/c1-33(2,31)29-5-3-27(4-6-29)13-15-24-25-18-17(28-7-9-32-10-8-28)23-16(26-30(15)18)14-11-21-19(20)22-12-14/h11-12H,1,3-10,13H2,2H3,(H2,20,21,22) |
| InChIKey | FRSXQZBIMMZQGK-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|