C15H18N8O — CID 143903048
5-(9-ethyl-6-morpholin-4-ylpurin-2-yl)pyrimidin-2-amine (PubChem CID 143903048) has the molecular formula C15H18N8O and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-(9-ethyl-6-morpholin-4-ylpurin-2-yl)pyrimidin-2-amine.
| Compound Name | 5-(9-ethyl-6-morpholin-4-ylpurin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143903048 |
| Molecular Formula | C15H18N8O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 5-(9-ethyl-6-morpholin-4-ylpurin-2-yl)pyrimidin-2-amine |
| SMILES | CCn1cnc2c(N3CCOCC3)nc(-c3cnc(N)nc3)nc21 |
| InChI | InChI=1S/C15H18N8O/c1-2-22-9-19-11-13(22)20-12(10-7-17-15(16)18-8-10)21-14(11)23-3-5-24-6-4-23/h7-9H,2-6H2,1H3,(H2,16,17,18) |
| InChIKey | FUUKWBMJXIZPRX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |