C25H28N10O3 — CID 118374535
(E)-3-[4-[[2-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-ylpurin-9-yl]ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 118374535) has the molecular formula C25H28N10O3 and a molecular weight of 516.57 g/mol. Its IUPAC name is (E)-3-[4-[[2-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-ylpurin-9-yl]ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[2-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-ylpurin-9-yl]ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 118374535 |
| Molecular Formula | C25H28N10O3 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | (E)-3-[4-[[2-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-ylpurin-9-yl]ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c3ncn(CCNCc4ccc(/C=C/C(=O)NO)cc4)c3n2)cn1 |
| InChI | InChI=1S/C25H28N10O3/c26-25-28-14-19(15-29-25)22-31-23(34-9-11-38-12-10-34)21-24(32-22)35(16-30-21)8-7-27-13-18-3-1-17(2-4-18)5-6-20(36)33-37/h1-6,14-16,27,37H,7-13H2,(H,33,36)(H2,26,28,29)/b6-5+ |
| InChIKey | OEHABLKFQZZGAJ-AATRIKPKSA-N |
| XLogP | 1.01 |
| TPSA | 169.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|