C21H27N7O3 — CID 126580532
7-[2-(6-amino-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]-1-hydroxyheptan-2-one (PubChem CID 126580532) has the molecular formula C21H27N7O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 7-[2-(6-amino-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]-1-hydroxyheptan-2-one.
| Compound Name | 7-[2-(6-amino-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]-1-hydroxyheptan-2-one |
|---|---|
| PubChem CID | 126580532 |
| Molecular Formula | C21H27N7O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 7-[2-(6-amino-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]-1-hydroxyheptan-2-one |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)c3ncn(CCCCCC(=O)CO)c3n2)cn1 |
| InChI | InChI=1S/C21H27N7O3/c22-17-6-5-15(12-23-17)19-25-20(27-8-10-31-11-9-27)18-21(26-19)28(14-24-18)7-3-1-2-4-16(30)13-29/h5-6,12,14,29H,1-4,7-11,13H2,(H2,22,23) |
| InChIKey | HKUFULJLLSLNSJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|