C22H31N9O2 — CID 126580548
7-[2-(2-aminopyrimidin-5-yl)-6-(4-hydroxypiperidin-1-yl)purin-9-yl]-N-methylheptanamide (PubChem CID 126580548) has the molecular formula C22H31N9O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 7-[2-(2-aminopyrimidin-5-yl)-6-(4-hydroxypiperidin-1-yl)purin-9-yl]-N-methylheptanamide.
| Compound Name | 7-[2-(2-aminopyrimidin-5-yl)-6-(4-hydroxypiperidin-1-yl)purin-9-yl]-N-methylheptanamide |
|---|---|
| PubChem CID | 126580548 |
| Molecular Formula | C22H31N9O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 7-[2-(2-aminopyrimidin-5-yl)-6-(4-hydroxypiperidin-1-yl)purin-9-yl]-N-methylheptanamide |
| SMILES | CNC(=O)CCCCCCn1cnc2c(N3CCC(O)CC3)nc(-c3cnc(N)nc3)nc21 |
| InChI | InChI=1S/C22H31N9O2/c1-24-17(33)6-4-2-3-5-9-31-14-27-18-20(30-10-7-16(32)8-11-30)28-19(29-21(18)31)15-12-25-22(23)26-13-15/h12-14,16,32H,2-11H2,1H3,(H,24,33)(H2,23,25,26) |
| InChIKey | OSWKZINPRAIYAR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|