C20H31N7O2 — CID 118374559
7-(2,6-dipyrrolidin-1-ylpurin-9-yl)-N-hydroxyheptanamide (PubChem CID 118374559) has the molecular formula C20H31N7O2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 7-(2,6-dipyrrolidin-1-ylpurin-9-yl)-N-hydroxyheptanamide.
| Compound Name | 7-(2,6-dipyrrolidin-1-ylpurin-9-yl)-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 118374559 |
| Molecular Formula | C20H31N7O2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 7-(2,6-dipyrrolidin-1-ylpurin-9-yl)-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCn1cnc2c(N3CCCC3)nc(N3CCCC3)nc21)NO |
| InChI | InChI=1S/C20H31N7O2/c28-16(24-29)9-3-1-2-4-14-27-15-21-17-18(25-10-5-6-11-25)22-20(23-19(17)27)26-12-7-8-13-26/h15,29H,1-14H2,(H,24,28) |
| InChIKey | DVCUEJTVFIDJPN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|