C26H26N8O3 — CID 155103782
methyl 3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-indazol-1-ylpurin-9-yl]propanoate (PubChem CID 155103782) has the molecular formula C26H26N8O3 and a molecular weight of 498.55 g/mol. Its IUPAC name is methyl 3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-indazol-1-ylpurin-9-yl]propanoate.
| Compound Name | methyl 3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-indazol-1-ylpurin-9-yl]propanoate |
|---|---|
| PubChem CID | 155103782 |
| Molecular Formula | C26H26N8O3 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | methyl 3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-indazol-1-ylpurin-9-yl]propanoate |
| SMILES | COC(=O)CCn1cnc2c(-n3ncc4ccccc43)nc(N3CCN(c4ccc(O)cc4)CC3)nc21 |
| InChI | InChI=1S/C26H26N8O3/c1-37-22(36)10-11-33-17-27-23-24(33)29-26(30-25(23)34-21-5-3-2-4-18(21)16-28-34)32-14-12-31(13-15-32)19-6-8-20(35)9-7-19/h2-9,16-17,35H,10-15H2,1H3 |
| InChIKey | CFQMGMUISISELF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |