C27H23N9O — CID 155102877
4-[4-(6-indazol-1-yl-9-pyridin-3-ylpurin-2-yl)piperazin-1-yl]phenol (PubChem CID 155102877) has the molecular formula C27H23N9O and a molecular weight of 489.54 g/mol. Its IUPAC name is 4-[4-(6-indazol-1-yl-9-pyridin-3-ylpurin-2-yl)piperazin-1-yl]phenol.
| Compound Name | 4-[4-(6-indazol-1-yl-9-pyridin-3-ylpurin-2-yl)piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 155102877 |
| Molecular Formula | C27H23N9O |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 4-[4-(6-indazol-1-yl-9-pyridin-3-ylpurin-2-yl)piperazin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCN(c3nc(-n4ncc5ccccc54)c4ncn(-c5cccnc5)c4n3)CC2)cc1 |
| InChI | InChI=1S/C27H23N9O/c37-22-9-7-20(8-10-22)33-12-14-34(15-13-33)27-31-25-24(29-18-35(25)21-5-3-11-28-17-21)26(32-27)36-23-6-2-1-4-19(23)16-30-36/h1-11,16-18,37H,12-15H2 |
| InChIKey | QKNCJUWIJCHOSW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |