C25H24N8O4 — CID 155103007
2-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-(6-methoxyindazol-1-yl)purin-9-yl]acetic acid (PubChem CID 155103007) has the molecular formula C25H24N8O4 and a molecular weight of 500.52 g/mol. Its IUPAC name is 2-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-(6-methoxyindazol-1-yl)purin-9-yl]acetic acid.
| Compound Name | 2-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-(6-methoxyindazol-1-yl)purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 155103007 |
| Molecular Formula | C25H24N8O4 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 2-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-(6-methoxyindazol-1-yl)purin-9-yl]acetic acid |
| SMILES | COc1ccc2cnn(-c3nc(N4CCN(c5ccc(O)cc5)CC4)nc4c3ncn4CC(=O)O)c2c1 |
| InChI | InChI=1S/C25H24N8O4/c1-37-19-7-2-16-13-27-33(20(16)12-19)24-22-23(32(15-26-22)14-21(35)36)28-25(29-24)31-10-8-30(9-11-31)17-3-5-18(34)6-4-17/h2-7,12-13,15,34H,8-11,14H2,1H3,(H,35,36) |
| InChIKey | GTMPRJJDXKYANT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |