C25H26N8O2 — CID 155102949
4-[4-[9-(2-hydroxyethyl)-6-indazol-1-ylpurin-2-yl]piperazin-1-yl]-2-methylphenol (PubChem CID 155102949) has the molecular formula C25H26N8O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is 4-[4-[9-(2-hydroxyethyl)-6-indazol-1-ylpurin-2-yl]piperazin-1-yl]-2-methylphenol.
| Compound Name | 4-[4-[9-(2-hydroxyethyl)-6-indazol-1-ylpurin-2-yl]piperazin-1-yl]-2-methylphenol |
|---|---|
| PubChem CID | 155102949 |
| Molecular Formula | C25H26N8O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 4-[4-[9-(2-hydroxyethyl)-6-indazol-1-ylpurin-2-yl]piperazin-1-yl]-2-methylphenol |
| SMILES | Cc1cc(N2CCN(c3nc(-n4ncc5ccccc54)c4ncn(CCO)c4n3)CC2)ccc1O |
| InChI | InChI=1S/C25H26N8O2/c1-17-14-19(6-7-21(17)35)30-8-10-31(11-9-30)25-28-23-22(26-16-32(23)12-13-34)24(29-25)33-20-5-3-2-4-18(20)15-27-33/h2-7,14-16,34-35H,8-13H2,1H3 |
| InChIKey | MXAHPLOQVGCGHT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |