C18H22N6O2 — CID 155102762
4-[4-[9-(2-hydroxyethyl)-6-methylpurin-2-yl]piperazin-1-yl]phenol (PubChem CID 155102762) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-[4-[9-(2-hydroxyethyl)-6-methylpurin-2-yl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[9-(2-hydroxyethyl)-6-methylpurin-2-yl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 155102762 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-[4-[9-(2-hydroxyethyl)-6-methylpurin-2-yl]piperazin-1-yl]phenol |
| SMILES | Cc1nc(N2CCN(c3ccc(O)cc3)CC2)nc2c1ncn2CCO |
| InChI | InChI=1S/C18H22N6O2/c1-13-16-17(24(10-11-25)12-19-16)21-18(20-13)23-8-6-22(7-9-23)14-2-4-15(26)5-3-14/h2-5,12,25-26H,6-11H2,1H3 |
| InChIKey | CIZNXNSSENTVEP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |